C7H3N2O2S- — CID 19065831
1,2,3-benzothiadiazole-7-carboxylate (PubChem CID 19065831) has the molecular formula C7H3N2O2S- and a molecular weight of 179.18 g/mol. Its IUPAC name is 1,2,3-benzothiadiazole-7-carboxylate.
| Compound Name | 1,2,3-benzothiadiazole-7-carboxylate |
|---|---|
| PubChem CID | 19065831 |
| Molecular Formula | C7H3N2O2S- |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | 1,2,3-benzothiadiazole-7-carboxylate |
| SMILES | O=C([O-])c1cccc2nnsc12 |
| InChI | InChI=1S/C7H4N2O2S/c10-7(11)4-2-1-3-5-6(4)12-9-8-5/h1-3H,(H,10,11)/p-1 |
| InChIKey | COAIOOWBEPAOFY-UHFFFAOYSA-M |
| XLogP | 0.05 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |