C9H12N2S — CID 145493236
ethane;7-methyl-1,2,3-benzothiadiazole (PubChem CID 145493236) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is ethane;7-methyl-1,2,3-benzothiadiazole.
| Compound Name | ethane;7-methyl-1,2,3-benzothiadiazole |
|---|---|
| PubChem CID | 145493236 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | ethane;7-methyl-1,2,3-benzothiadiazole |
| SMILES | CC.Cc1cccc2nnsc12 |
| InChI | InChI=1S/C7H6N2S.C2H6/c1-5-3-2-4-6-7(5)10-9-8-6;1-2/h2-4H,1H3;1-2H3 |
| InChIKey | XAXIRQQGHWGJBO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |