C22H8F38NSi — CID 19068667
CID 19068667 (PubChem CID 19068667) has the molecular formula C22H8F38NSi and a molecular weight of 1036.32 g/mol.
| Compound Name | CID 19068667 |
|---|---|
| PubChem CID | 19068667 |
| Molecular Formula | C22H8F38NSi |
| Molecular Weight | 1036.32 g/mol |
| Exact Mass | 1035.98 |
| IUPAC Name | — |
| SMILES | CCCC(N[Si])(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H8F38NSi/c1-2-3-4(61-62,5(23,24)7(27,28)9(31,32)11(35,36)13(39,40)15(43,44)17(47,48)19(51,52)21(55,56)57)6(25,26)8(29,30)10(33,34)12(37,38)14(41,42)16(45,46)18(49,50)20(53,54)22(58,59)60/h61H,2-3H2,1H3 |
| InChIKey | WQKNJVFVPGKCNX-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.32 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|