C37H28N2O3S3 — CID 19069074
3-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-[4-(quinolin-2-ylmethoxy)phenyl]thiophen-2-yl]propanethioic S-acid (PubChem CID 19069074) has the molecular formula C37H28N2O3S3 and a molecular weight of 644.84 g/mol. Its IUPAC name is 3-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-[4-(quinolin-2-ylmethoxy)phenyl]thiophen-2-yl]propanethioic S-acid.
| Compound Name | 3-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-[4-(quinolin-2-ylmethoxy)phenyl]thiophen-2-yl]propanethioic S-acid |
|---|---|
| PubChem CID | 19069074 |
| Molecular Formula | C37H28N2O3S3 |
| Molecular Weight | 644.84 g/mol |
| Exact Mass | 644.13 |
| IUPAC Name | 3-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-[4-(quinolin-2-ylmethoxy)phenyl]thiophen-2-yl]propanethioic S-acid |
| SMILES | O=C(S)CCc1scc(-c2ccc(OCc3nc4ccccc4s3)cc2)c1-c1ccc(OCc2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C37H28N2O3S3/c40-36(43)20-19-34-37(26-12-17-28(18-13-26)41-21-27-14-9-25-5-1-2-6-31(25)38-27)30(23-44-34)24-10-15-29(16-11-24)42-22-35-39-32-7-3-4-8-33(32)45-35/h1-18,23H,19-22H2,(H,40,43) |
| InChIKey | OZCVYASJJNZSCM-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 61.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.84 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|