C18H30N6O3 — CID 19069528
2,4,6-tris(2-methoxypyrrolidin-1-yl)-1,3,5-triazine (PubChem CID 19069528) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2,4,6-tris(2-methoxypyrrolidin-1-yl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(2-methoxypyrrolidin-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 19069528 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2,4,6-tris(2-methoxypyrrolidin-1-yl)-1,3,5-triazine |
| SMILES | COC1CCCN1c1nc(N2CCCC2OC)nc(N2CCCC2OC)n1 |
| InChI | InChI=1S/C18H30N6O3/c1-25-13-7-4-10-22(13)16-19-17(23-11-5-8-14(23)26-2)21-18(20-16)24-12-6-9-15(24)27-3/h13-15H,4-12H2,1-3H3 |
| InChIKey | PBDIJAHDZRQZSA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 76.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |