C26H46N6O6 — CID 19071040
tert-butyl 2-carbamimidoyl-4-[3-[5-[[4-(3-methoxy-3-oxopropyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]piperidine-1-carboxylate (PubChem CID 19071040) has the molecular formula C26H46N6O6 and a molecular weight of 538.69 g/mol. Its IUPAC name is tert-butyl 2-carbamimidoyl-4-[3-[5-[[4-(3-methoxy-3-oxopropyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-carbamimidoyl-4-[3-[5-[[4-(3-methoxy-3-oxopropyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 19071040 |
| Molecular Formula | C26H46N6O6 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | tert-butyl 2-carbamimidoyl-4-[3-[5-[[4-(3-methoxy-3-oxopropyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]piperidine-1-carboxylate |
| SMILES | [H]/N=C(\N)C1CC(CCCN2CC(CN3CCN(CCC(=O)OC)CC3)OC2=O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H46N6O6/c1-26(2,3)38-25(35)32-11-7-19(16-21(32)23(27)28)6-5-9-31-18-20(37-24(31)34)17-30-14-12-29(13-15-30)10-8-22(33)36-4/h19-21H,5-18H2,1-4H3,(H3,27,28) |
| InChIKey | OYWANVTYNHRUJA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|