C27H48N6O6 — CID 19071276
tert-butyl 2-carbamimidoyl-4-[4-[5-[[4-(3-methoxy-3-oxopropyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]butyl]piperidine-1-carboxylate (PubChem CID 19071276) has the molecular formula C27H48N6O6 and a molecular weight of 552.72 g/mol. Its IUPAC name is tert-butyl 2-carbamimidoyl-4-[4-[5-[[4-(3-methoxy-3-oxopropyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]butyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-carbamimidoyl-4-[4-[5-[[4-(3-methoxy-3-oxopropyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]butyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 19071276 |
| Molecular Formula | C27H48N6O6 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | tert-butyl 2-carbamimidoyl-4-[4-[5-[[4-(3-methoxy-3-oxopropyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]butyl]piperidine-1-carboxylate |
| SMILES | [H]/N=C(\N)C1CC(CCCCN2CC(CN3CCN(CCC(=O)OC)CC3)OC2=O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H48N6O6/c1-27(2,3)39-26(36)33-12-8-20(17-22(33)24(28)29)7-5-6-10-32-19-21(38-25(32)35)18-31-15-13-30(14-16-31)11-9-23(34)37-4/h20-22H,5-19H2,1-4H3,(H3,28,29) |
| InChIKey | VKUHPABVTIKFCG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|