C24H43N7O6 — CID 19071246
tert-butyl 2-carbamimidoyl-4-[3-[5-[[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]piperazine-1-carboxylate (PubChem CID 19071246) has the molecular formula C24H43N7O6 and a molecular weight of 525.65 g/mol. Its IUPAC name is tert-butyl 2-carbamimidoyl-4-[3-[5-[[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-carbamimidoyl-4-[3-[5-[[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 19071246 |
| Molecular Formula | C24H43N7O6 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.33 |
| IUPAC Name | tert-butyl 2-carbamimidoyl-4-[3-[5-[[4-(2-methoxy-2-oxoethyl)piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]propyl]piperazine-1-carboxylate |
| SMILES | [H]/N=C(\N)C1CN(CCCN2CC(CN3CCN(CC(=O)OC)CC3)OC2=O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H43N7O6/c1-24(2,3)37-23(34)31-13-12-27(16-19(31)21(25)26)6-5-7-30-15-18(36-22(30)33)14-28-8-10-29(11-9-28)17-20(32)35-4/h18-19H,5-17H2,1-4H3,(H3,25,26) |
| InChIKey | MSYLCORVZPKXCW-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 144.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|