C33H34N4O4 — CID 19074639
4-(2,5-dioxo-3-phenylpiperazin-1-yl)-2-(1H-indol-3-ylmethyl)-3-oxo-N-[(3,4,5-trimethylphenyl)methyl]butanamide (PubChem CID 19074639) has the molecular formula C33H34N4O4 and a molecular weight of 550.66 g/mol. Its IUPAC name is 4-(2,5-dioxo-3-phenylpiperazin-1-yl)-2-(1H-indol-3-ylmethyl)-3-oxo-N-[(3,4,5-trimethylphenyl)methyl]butanamide.
| Compound Name | 4-(2,5-dioxo-3-phenylpiperazin-1-yl)-2-(1H-indol-3-ylmethyl)-3-oxo-N-[(3,4,5-trimethylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 19074639 |
| Molecular Formula | C33H34N4O4 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 4-(2,5-dioxo-3-phenylpiperazin-1-yl)-2-(1H-indol-3-ylmethyl)-3-oxo-N-[(3,4,5-trimethylphenyl)methyl]butanamide |
| SMILES | Cc1cc(CNC(=O)C(Cc2c[nH]c3ccccc23)C(=O)CN2CC(=O)NC(c3ccccc3)C2=O)cc(C)c1C |
| InChI | InChI=1S/C33H34N4O4/c1-20-13-23(14-21(2)22(20)3)16-35-32(40)27(15-25-17-34-28-12-8-7-11-26(25)28)29(38)18-37-19-30(39)36-31(33(37)41)24-9-5-4-6-10-24/h4-14,17,27,31,34H,15-16,18-19H2,1-3H3,(H,35,40)(H,36,39) |
| InChIKey | NSDMCMPRRLLNKV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|