C32H32N4O5 — CID 19074707
4-(2,5-dioxo-3-phenylpiperazin-1-yl)-N-[(2-ethoxyphenyl)methyl]-2-(1H-indol-3-ylmethyl)-3-oxobutanamide (PubChem CID 19074707) has the molecular formula C32H32N4O5 and a molecular weight of 552.63 g/mol. Its IUPAC name is 4-(2,5-dioxo-3-phenylpiperazin-1-yl)-N-[(2-ethoxyphenyl)methyl]-2-(1H-indol-3-ylmethyl)-3-oxobutanamide.
| Compound Name | 4-(2,5-dioxo-3-phenylpiperazin-1-yl)-N-[(2-ethoxyphenyl)methyl]-2-(1H-indol-3-ylmethyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 19074707 |
| Molecular Formula | C32H32N4O5 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.24 |
| IUPAC Name | 4-(2,5-dioxo-3-phenylpiperazin-1-yl)-N-[(2-ethoxyphenyl)methyl]-2-(1H-indol-3-ylmethyl)-3-oxobutanamide |
| SMILES | CCOc1ccccc1CNC(=O)C(Cc1c[nH]c2ccccc12)C(=O)CN1CC(=O)NC(c2ccccc2)C1=O |
| InChI | InChI=1S/C32H32N4O5/c1-2-41-28-15-9-6-12-22(28)17-34-31(39)25(16-23-18-33-26-14-8-7-13-24(23)26)27(37)19-36-20-29(38)35-30(32(36)40)21-10-4-3-5-11-21/h3-15,18,25,30,33H,2,16-17,19-20H2,1H3,(H,34,39)(H,35,38) |
| InChIKey | ZIXBPDZESYLDPK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|