C21H31N3O5S — CID 19075520
(E)-but-2-enedioic acid;3-(3-cyclohexylpropoxy)-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole (PubChem CID 19075520) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-(3-cyclohexylpropoxy)-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole.
| Compound Name | (E)-but-2-enedioic acid;3-(3-cyclohexylpropoxy)-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 19075520 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (E)-but-2-enedioic acid;3-(3-cyclohexylpropoxy)-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole |
| SMILES | CN1CCC=C(c2nsnc2OCCCC2CCCCC2)C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H27N3OS.C4H4O4/c1-20-11-5-10-15(13-20)16-17(19-22-18-16)21-12-6-9-14-7-3-2-4-8-14;5-3(6)1-2-4(7)8/h10,14H,2-9,11-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | NDPCEBAEXGRCON-WLHGVMLRSA-N |
| XLogP | 3.71 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|