C15H23N3OS — CID 54376367
3-(3-cyclobutylpropoxy)-4-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole (PubChem CID 54376367) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is 3-(3-cyclobutylpropoxy)-4-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole.
| Compound Name | 3-(3-cyclobutylpropoxy)-4-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 54376367 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-(3-cyclobutylpropoxy)-4-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-1,2,5-thiadiazole |
| SMILES | CC1NCCC=C1c1nsnc1OCCCC1CCC1 |
| InChI | InChI=1S/C15H23N3OS/c1-11-13(8-3-9-16-11)14-15(18-20-17-14)19-10-4-7-12-5-2-6-12/h8,11-12,16H,2-7,9-10H2,1H3 |
| InChIKey | UWTWDMOTMIBSQN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|