C21H32Cl2N6O2S2 — CID 11734200
3-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-4-[5-[[4-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-1,2,5-thiadiazol-3-yl]oxy]pentoxy]-1,2,5-thiadiazole dichloride (PubChem CID 11734200) has the molecular formula C21H32Cl2N6O2S2 and a molecular weight of 535.57 g/mol. Its IUPAC name is 3-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-4-[5-[[4-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-1,2,5-thiadiazol-3-yl]oxy]pentoxy]-1,2,5-thiadiazole dichloride.
| Compound Name | 3-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-4-[5-[[4-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-1,2,5-thiadiazol-3-yl]oxy]pentoxy]-1,2,5-thiadiazole dichloride |
|---|---|
| PubChem CID | 11734200 |
| Molecular Formula | C21H32Cl2N6O2S2 |
| Molecular Weight | 535.57 g/mol |
| Exact Mass | 534.14 |
| IUPAC Name | 3-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-4-[5-[[4-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-1,2,5-thiadiazol-3-yl]oxy]pentoxy]-1,2,5-thiadiazole dichloride |
| SMILES | C[NH+]1CCC=C(c2nsnc2OCCCCCOc2nsnc2C2=CCC[NH+](C)C2)C1.[Cl-].[Cl-] |
| InChI | InChI=1S/C21H30N6O2S2.2ClH/c1-26-10-6-8-16(14-26)18-20(24-30-22-18)28-12-4-3-5-13-29-21-19(23-31-25-21)17-9-7-11-27(2)15-17;;/h8-9H,3-7,10-15H2,1-2H3;2*1H |
| InChIKey | ZAHXHHGBHRRKBL-UHFFFAOYSA-N |
| XLogP | -5.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.57 |
| LogP ≤ 5 | -5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|