C34H56N6O4S2 — CID 19075501
bis(3-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-4-octyl-1,2,5-thiadiazole);oxalate (PubChem CID 19075501) has the molecular formula C34H56N6O4S2 and a molecular weight of 676.99 g/mol. Its IUPAC name is bis(3-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-4-octyl-1,2,5-thiadiazole);oxalate.
| Compound Name | bis(3-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-4-octyl-1,2,5-thiadiazole);oxalate |
|---|---|
| PubChem CID | 19075501 |
| Molecular Formula | C34H56N6O4S2 |
| Molecular Weight | 676.99 g/mol |
| Exact Mass | 676.38 |
| IUPAC Name | bis(3-(1-methyl-1,2,3,6-tetrahydropyridin-1-ium-5-yl)-4-octyl-1,2,5-thiadiazole);oxalate |
| SMILES | CCCCCCCCc1nsnc1C1=CCC[NH+](C)C1.CCCCCCCCc1nsnc1C1=CCC[NH+](C)C1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C16H27N3S.C2H2O4/c2*1-3-4-5-6-7-8-11-15-16(18-20-17-15)14-10-9-12-19(2)13-14;3-1(4)2(5)6/h2*10H,3-9,11-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | OBKRAJCYJDBNNP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.99 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|