C12H19N3O2S — CID 70300002
3-(2-azabicyclo[2.2.1]heptan-5-yloxy)-4-butoxy-1,2,5-thiadiazole (PubChem CID 70300002) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 3-(2-azabicyclo[2.2.1]heptan-5-yloxy)-4-butoxy-1,2,5-thiadiazole.
| Compound Name | 3-(2-azabicyclo[2.2.1]heptan-5-yloxy)-4-butoxy-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 70300002 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-(2-azabicyclo[2.2.1]heptan-5-yloxy)-4-butoxy-1,2,5-thiadiazole |
| SMILES | CCCCOc1nsnc1OC1CC2CC1CN2 |
| InChI | InChI=1S/C12H19N3O2S/c1-2-3-4-16-11-12(15-18-14-11)17-10-6-9-5-8(10)7-13-9/h8-10,13H,2-7H2,1H3 |
| InChIKey | VAWLABXCASOQSN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|