C15H23F3N4O3S — CID 19804288
3-heptoxy-4-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,5-thiadiazole;2,2,2-trifluoroacetic acid (PubChem CID 19804288) has the molecular formula C15H23F3N4O3S and a molecular weight of 396.44 g/mol. Its IUPAC name is 3-heptoxy-4-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,5-thiadiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 3-heptoxy-4-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,5-thiadiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 19804288 |
| Molecular Formula | C15H23F3N4O3S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 3-heptoxy-4-(1,4,5,6-tetrahydropyrimidin-5-yl)-1,2,5-thiadiazole;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCCOc1nsnc1C1CN=CNC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H22N4OS.C2HF3O2/c1-2-3-4-5-6-7-18-13-12(16-19-17-13)11-8-14-10-15-9-11;3-2(4,5)1(6)7/h10-11H,2-9H2,1H3,(H,14,15);(H,6,7) |
| InChIKey | ZAQZNALORFSHPW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 96.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|