C25H41N3O10S — CID 67770196
3-hexoxy-4-(2-hexoxy-1-azabicyclo[2.2.2]octan-3-yl)-1,2,5-thiadiazole;oxalic acid (PubChem CID 67770196) has the molecular formula C25H41N3O10S and a molecular weight of 575.68 g/mol. Its IUPAC name is 3-hexoxy-4-(2-hexoxy-1-azabicyclo[2.2.2]octan-3-yl)-1,2,5-thiadiazole;oxalic acid.
| Compound Name | 3-hexoxy-4-(2-hexoxy-1-azabicyclo[2.2.2]octan-3-yl)-1,2,5-thiadiazole;oxalic acid |
|---|---|
| PubChem CID | 67770196 |
| Molecular Formula | C25H41N3O10S |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | 3-hexoxy-4-(2-hexoxy-1-azabicyclo[2.2.2]octan-3-yl)-1,2,5-thiadiazole;oxalic acid |
| SMILES | CCCCCCOc1nsnc1C1C2CCN(CC2)C1OCCCCCC.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H37N3O2S.2C2H2O4/c1-3-5-7-9-15-25-20-19(22-27-23-20)18-17-11-13-24(14-12-17)21(18)26-16-10-8-6-4-2;2*3-1(4)2(5)6/h17-18,21H,3-16H2,1-2H3;2*(H,3,4)(H,5,6) |
| InChIKey | ZGJLZWOIHNDAGH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 196.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|