C19H29N3O5S — CID 70199408
3-(1-azabicyclo[2.2.2]octan-3-yl)-4-hexoxy-1,2,5-thiadiazole;but-2-enedioic acid (PubChem CID 70199408) has the molecular formula C19H29N3O5S and a molecular weight of 411.52 g/mol. Its IUPAC name is 3-(1-azabicyclo[2.2.2]octan-3-yl)-4-hexoxy-1,2,5-thiadiazole;but-2-enedioic acid.
| Compound Name | 3-(1-azabicyclo[2.2.2]octan-3-yl)-4-hexoxy-1,2,5-thiadiazole;but-2-enedioic acid |
|---|---|
| PubChem CID | 70199408 |
| Molecular Formula | C19H29N3O5S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 3-(1-azabicyclo[2.2.2]octan-3-yl)-4-hexoxy-1,2,5-thiadiazole;but-2-enedioic acid |
| SMILES | CCCCCCOc1nsnc1C1CN2CCC1CC2.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C15H25N3OS.C4H4O4/c1-2-3-4-5-10-19-15-14(16-20-17-15)13-11-18-8-6-12(13)7-9-18;5-3(6)1-2-4(7)8/h12-13H,2-11H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | BXONEOKXOIEICL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|