C17H27N3O6S2 — CID 131719928
3-[(5S,6S)-1-azabicyclo[3.2.1]octan-6-yl]-4-butylsulfanyl-1,2,5-thiadiazole;(2R,3R)-2,3-dihydroxybutanedioic acid (PubChem CID 131719928) has the molecular formula C17H27N3O6S2 and a molecular weight of 433.55 g/mol. Its IUPAC name is 3-[(5S,6S)-1-azabicyclo[3.2.1]octan-6-yl]-4-butylsulfanyl-1,2,5-thiadiazole;(2R,3R)-2,3-dihydroxybutanedioic acid.
| Compound Name | 3-[(5S,6S)-1-azabicyclo[3.2.1]octan-6-yl]-4-butylsulfanyl-1,2,5-thiadiazole;(2R,3R)-2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 131719928 |
| Molecular Formula | C17H27N3O6S2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 3-[(5S,6S)-1-azabicyclo[3.2.1]octan-6-yl]-4-butylsulfanyl-1,2,5-thiadiazole;(2R,3R)-2,3-dihydroxybutanedioic acid |
| SMILES | CCCCSc1nsnc1[C@@H]1CN2CCC[C@@H]1C2.O=C(O)[C@H](O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C13H21N3S2.C4H6O6/c1-2-3-7-17-13-12(14-18-15-13)11-9-16-6-4-5-10(11)8-16;5-1(3(7)8)2(6)4(9)10/h10-11H,2-9H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t10-,11-;1-,2-/m11/s1 |
| InChIKey | TXWSSIXKBLQVTM-RYXFHKDPSA-N |
| XLogP | 1.12 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|