C14H23IN3S2+ — CID 18704932
3-butylsulfanyl-4-(2-iodo-1-methyl-1-azoniabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazole (PubChem CID 18704932) has the molecular formula C14H23IN3S2+ and a molecular weight of 424.40 g/mol. Its IUPAC name is 3-butylsulfanyl-4-(2-iodo-1-methyl-1-azoniabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazole.
| Compound Name | 3-butylsulfanyl-4-(2-iodo-1-methyl-1-azoniabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 18704932 |
| Molecular Formula | C14H23IN3S2+ |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 3-butylsulfanyl-4-(2-iodo-1-methyl-1-azoniabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazole |
| SMILES | CCCCSc1nsnc1C1C[N+]2(C)CC1CCC2I |
| InChI | InChI=1S/C14H23IN3S2/c1-3-4-7-19-14-13(16-20-17-14)11-9-18(2)8-10(11)5-6-12(18)15/h10-12H,3-9H2,1-2H3/q+1 |
| InChIKey | CENAZPRTYZNOCN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|