C24H32N6O4S4 — CID 57206230
bis[2-[[4-(1-azabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]ethyl] oxalate (PubChem CID 57206230) has the molecular formula C24H32N6O4S4 and a molecular weight of 596.83 g/mol. Its IUPAC name is bis[2-[[4-(1-azabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]ethyl] oxalate.
| Compound Name | bis[2-[[4-(1-azabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]ethyl] oxalate |
|---|---|
| PubChem CID | 57206230 |
| Molecular Formula | C24H32N6O4S4 |
| Molecular Weight | 596.83 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | bis[2-[[4-(1-azabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazol-3-yl]sulfanyl]ethyl] oxalate |
| SMILES | O=C(OCCSc1nsnc1C1CN2CCCC1C2)C(=O)OCCSc1nsnc1C1CN2CCCC1C2 |
| InChI | InChI=1S/C24H32N6O4S4/c31-23(33-7-9-35-21-19(25-37-27-21)17-13-29-5-1-3-15(17)11-29)24(32)34-8-10-36-22-20(26-38-28-22)18-14-30-6-2-4-16(18)12-30/h15-18H,1-14H2 |
| InChIKey | UNAKUJJDIRTKCW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 110.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.83 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|