C18H17Cl2N3S2 — CID 19365837
3-(1-azabicyclo[2.2.2]octan-3-yl)-4-[3-(3,5-dichlorophenyl)prop-2-ynylsulfanyl]-1,2,5-thiadiazole (PubChem CID 19365837) has the molecular formula C18H17Cl2N3S2 and a molecular weight of 410.40 g/mol. Its IUPAC name is 3-(1-azabicyclo[2.2.2]octan-3-yl)-4-[3-(3,5-dichlorophenyl)prop-2-ynylsulfanyl]-1,2,5-thiadiazole.
| Compound Name | 3-(1-azabicyclo[2.2.2]octan-3-yl)-4-[3-(3,5-dichlorophenyl)prop-2-ynylsulfanyl]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 19365837 |
| Molecular Formula | C18H17Cl2N3S2 |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | 3-(1-azabicyclo[2.2.2]octan-3-yl)-4-[3-(3,5-dichlorophenyl)prop-2-ynylsulfanyl]-1,2,5-thiadiazole |
| SMILES | Clc1cc(Cl)cc(C#CCSc2nsnc2C2CN3CCC2CC3)c1 |
| InChI | InChI=1S/C18H17Cl2N3S2/c19-14-8-12(9-15(20)10-14)2-1-7-24-18-17(21-25-22-18)16-11-23-5-3-13(16)4-6-23/h8-10,13,16H,3-7,11H2 |
| InChIKey | ZRFYBKXOHVIESQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|