C14H23N3S2 — CID 100925167
3-[(5S,6S)-1-azabicyclo[3.2.1]octan-6-yl]-4-pentylsulfanyl-1,2,5-thiadiazole (PubChem CID 100925167) has the molecular formula C14H23N3S2 and a molecular weight of 297.49 g/mol. Its IUPAC name is 3-[(5S,6S)-1-azabicyclo[3.2.1]octan-6-yl]-4-pentylsulfanyl-1,2,5-thiadiazole.
| Compound Name | 3-[(5S,6S)-1-azabicyclo[3.2.1]octan-6-yl]-4-pentylsulfanyl-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 100925167 |
| Molecular Formula | C14H23N3S2 |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 3-[(5S,6S)-1-azabicyclo[3.2.1]octan-6-yl]-4-pentylsulfanyl-1,2,5-thiadiazole |
| SMILES | CCCCCSc1nsnc1[C@@H]1CN2CCC[C@@H]1C2 |
| InChI | InChI=1S/C14H23N3S2/c1-2-3-4-8-18-14-13(15-19-16-14)12-10-17-7-5-6-11(12)9-17/h11-12H,2-10H2,1H3/t11-,12-/m1/s1 |
| InChIKey | ARGLYHMZTRCRQG-VXGBXAGGSA-N |
| XLogP | 3.63 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|