C17H20N4OS3 — CID 57056966
4-[[4-(1-azabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazol-3-yl]sulfanylmethyl]-N-sulfanylbenzamide (PubChem CID 57056966) has the molecular formula C17H20N4OS3 and a molecular weight of 392.58 g/mol. Its IUPAC name is 4-[[4-(1-azabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazol-3-yl]sulfanylmethyl]-N-sulfanylbenzamide.
| Compound Name | 4-[[4-(1-azabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazol-3-yl]sulfanylmethyl]-N-sulfanylbenzamide |
|---|---|
| PubChem CID | 57056966 |
| Molecular Formula | C17H20N4OS3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 4-[[4-(1-azabicyclo[3.2.1]octan-6-yl)-1,2,5-thiadiazol-3-yl]sulfanylmethyl]-N-sulfanylbenzamide |
| SMILES | O=C(NS)c1ccc(CSc2nsnc2C2CN3CCCC2C3)cc1 |
| InChI | InChI=1S/C17H20N4OS3/c22-16(18-23)12-5-3-11(4-6-12)10-24-17-15(19-25-20-17)14-9-21-7-1-2-13(14)8-21/h3-6,13-14,23H,1-2,7-10H2,(H,18,22) |
| InChIKey | CMBUSXFUWLAMFL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|