C14H23N3OS2 — CID 19600360
3-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)-4-butylsulfanyl-1,2,5-thiadiazole (PubChem CID 19600360) has the molecular formula C14H23N3OS2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 3-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)-4-butylsulfanyl-1,2,5-thiadiazole.
| Compound Name | 3-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)-4-butylsulfanyl-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 19600360 |
| Molecular Formula | C14H23N3OS2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-(1-azabicyclo[2.2.2]octan-3-ylmethoxy)-4-butylsulfanyl-1,2,5-thiadiazole |
| SMILES | CCCCSc1nsnc1OCC1CN2CCC1CC2 |
| InChI | InChI=1S/C14H23N3OS2/c1-2-3-8-19-14-13(15-20-16-14)18-10-12-9-17-6-4-11(12)5-7-17/h11-12H,2-10H2,1H3 |
| InChIKey | BXOHRMZNSWPVCB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|