C6H9ClN2S2 — CID 11052875
3-butylsulfanyl-4-chloro-1,2,5-thiadiazole (PubChem CID 11052875) has the molecular formula C6H9ClN2S2 and a molecular weight of 208.74 g/mol. Its IUPAC name is 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole.
| Compound Name | 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 11052875 |
| Molecular Formula | C6H9ClN2S2 |
| Molecular Weight | 208.74 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 3-butylsulfanyl-4-chloro-1,2,5-thiadiazole |
| SMILES | CCCCSc1nsnc1Cl |
| InChI | InChI=1S/C6H9ClN2S2/c1-2-3-4-10-6-5(7)8-11-9-6/h2-4H2,1H3 |
| InChIKey | PTUHKOUUGVLEFG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|