C14H24IN3S2 — CID 18704928
3-butylsulfanyl-4-(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-1,2,5-thiadiazole iodide (PubChem CID 18704928) has the molecular formula C14H24IN3S2 and a molecular weight of 425.41 g/mol. Its IUPAC name is 3-butylsulfanyl-4-(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-1,2,5-thiadiazole iodide.
| Compound Name | 3-butylsulfanyl-4-(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-1,2,5-thiadiazole iodide |
|---|---|
| PubChem CID | 18704928 |
| Molecular Formula | C14H24IN3S2 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 3-butylsulfanyl-4-(1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl)-1,2,5-thiadiazole iodide |
| SMILES | CCCCSc1nsnc1C1C[N+]2(C)CCC1CC2.[I-] |
| InChI | InChI=1S/C14H24N3S2.HI/c1-3-4-9-18-14-13(15-19-16-14)12-10-17(2)7-5-11(12)6-8-17;/h11-12H,3-10H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | VSSTVICRWYUOHL-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|