C8H12N2O2S2 — CID 134119627
3-butylsulfanyl-5-methoxy-1,2,6-thiadiazin-4-one (PubChem CID 134119627) has the molecular formula C8H12N2O2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-butylsulfanyl-5-methoxy-1,2,6-thiadiazin-4-one.
| Compound Name | 3-butylsulfanyl-5-methoxy-1,2,6-thiadiazin-4-one |
|---|---|
| PubChem CID | 134119627 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 3-butylsulfanyl-5-methoxy-1,2,6-thiadiazin-4-one |
| SMILES | CCCCSc1nsnc(OC)c1=O |
| InChI | InChI=1S/C8H12N2O2S2/c1-3-4-5-13-8-6(11)7(12-2)9-14-10-8/h3-5H2,1-2H3 |
| InChIKey | CPAUARGXAHJOLX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|