C6H11ClN2S3 — CID 134989684
5-butylsulfanyl-1-chloro-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine (PubChem CID 134989684) has the molecular formula C6H11ClN2S3 and a molecular weight of 242.82 g/mol. Its IUPAC name is 5-butylsulfanyl-1-chloro-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine.
| Compound Name | 5-butylsulfanyl-1-chloro-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 134989684 |
| Molecular Formula | C6H11ClN2S3 |
| Molecular Weight | 242.82 g/mol |
| Exact Mass | 241.98 |
| IUPAC Name | 5-butylsulfanyl-1-chloro-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-amine |
| SMILES | CCCCSC1=S(Cl)SC(N)=N1 |
| InChI | InChI=1S/C6H11ClN2S3/c1-2-3-4-10-6-9-5(8)11-12(6)7/h2-4H2,1H3,(H2,8,9) |
| InChIKey | CXIOYNXGZRLVCC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.82 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|