C21H28ClNS — CID 19075676
N-methyl-N-pentyl-1-phenylsulfanyl-2,3-dihydro-1H-inden-2-amine;hydrochloride (PubChem CID 19075676) has the molecular formula C21H28ClNS and a molecular weight of 361.98 g/mol. Its IUPAC name is N-methyl-N-pentyl-1-phenylsulfanyl-2,3-dihydro-1H-inden-2-amine;hydrochloride.
| Compound Name | N-methyl-N-pentyl-1-phenylsulfanyl-2,3-dihydro-1H-inden-2-amine;hydrochloride |
|---|---|
| PubChem CID | 19075676 |
| Molecular Formula | C21H28ClNS |
| Molecular Weight | 361.98 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-methyl-N-pentyl-1-phenylsulfanyl-2,3-dihydro-1H-inden-2-amine;hydrochloride |
| SMILES | CCCCCN(C)C1Cc2ccccc2C1Sc1ccccc1.Cl |
| InChI | InChI=1S/C21H27NS.ClH/c1-3-4-10-15-22(2)20-16-17-11-8-9-14-19(17)21(20)23-18-12-6-5-7-13-18;/h5-9,11-14,20-21H,3-4,10,15-16H2,1-2H3;1H |
| InChIKey | QTOOSKYQABINCX-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.98 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|