C14H23NO7 — CID 19075833
2-(1,4-dioxan-2-yloxy)-2-(2-piperidin-1-ylethyl)propanedioic acid (PubChem CID 19075833) has the molecular formula C14H23NO7 and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-(1,4-dioxan-2-yloxy)-2-(2-piperidin-1-ylethyl)propanedioic acid.
| Compound Name | 2-(1,4-dioxan-2-yloxy)-2-(2-piperidin-1-ylethyl)propanedioic acid |
|---|---|
| PubChem CID | 19075833 |
| Molecular Formula | C14H23NO7 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-(1,4-dioxan-2-yloxy)-2-(2-piperidin-1-ylethyl)propanedioic acid |
| SMILES | O=C(O)C(CCN1CCCCC1)(OC1COCCO1)C(=O)O |
| InChI | InChI=1S/C14H23NO7/c16-12(17)14(13(18)19,22-11-10-20-8-9-21-11)4-7-15-5-2-1-3-6-15/h11H,1-10H2,(H,16,17)(H,18,19) |
| InChIKey | WMDZNQOURPBZFX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|