C18H19NO3 — CID 19081655
1-cyclohexyl-7-ethenyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 19081655) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-cyclohexyl-7-ethenyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclohexyl-7-ethenyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19081655 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-cyclohexyl-7-ethenyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | C=Cc1ccc2c(=O)c(C(=O)O)cn(C3CCCCC3)c2c1 |
| InChI | InChI=1S/C18H19NO3/c1-2-12-8-9-14-16(10-12)19(13-6-4-3-5-7-13)11-15(17(14)20)18(21)22/h2,8-11,13H,1,3-7H2,(H,21,22) |
| InChIKey | MVVNIPVONKXPEM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |