C16H8F3NO3 — CID 19090505
6,7-difluoro-1-(2-fluorophenyl)-4-oxoquinoline-2-carboxylic acid (PubChem CID 19090505) has the molecular formula C16H8F3NO3 and a molecular weight of 319.24 g/mol. Its IUPAC name is 6,7-difluoro-1-(2-fluorophenyl)-4-oxoquinoline-2-carboxylic acid.
| Compound Name | 6,7-difluoro-1-(2-fluorophenyl)-4-oxoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 19090505 |
| Molecular Formula | C16H8F3NO3 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 6,7-difluoro-1-(2-fluorophenyl)-4-oxoquinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cc(=O)c2cc(F)c(F)cc2n1-c1ccccc1F |
| InChI | InChI=1S/C16H8F3NO3/c17-9-3-1-2-4-12(9)20-13-6-11(19)10(18)5-8(13)15(21)7-14(20)16(22)23/h1-7H,(H,22,23) |
| InChIKey | VJHWZPKGJRQEFC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |