C12H6F3NO2S — CID 19092776
2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol (PubChem CID 19092776) has the molecular formula C12H6F3NO2S and a molecular weight of 285.25 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol.
| Compound Name | 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 19092776 |
| Molecular Formula | C12H6F3NO2S |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]-1-benzofuran-5-ol |
| SMILES | Oc1ccc2oc(-c3nc(C(F)(F)F)cs3)cc2c1 |
| InChI | InChI=1S/C12H6F3NO2S/c13-12(14,15)10-5-19-11(16-10)9-4-6-3-7(17)1-2-8(6)18-9/h1-5,17H |
| InChIKey | AUYLWBDILMAZNW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |