C8H16N2O — CID 19096916
N',N'-dimethyl-N-propylprop-2-enehydrazide (PubChem CID 19096916) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is N',N'-dimethyl-N-propylprop-2-enehydrazide.
| Compound Name | N',N'-dimethyl-N-propylprop-2-enehydrazide |
|---|---|
| PubChem CID | 19096916 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | N',N'-dimethyl-N-propylprop-2-enehydrazide |
| SMILES | C=CC(=O)N(CCC)N(C)C |
| InChI | InChI=1S/C8H16N2O/c1-5-7-10(9(3)4)8(11)6-2/h6H,2,5,7H2,1,3-4H3 |
| InChIKey | FGMDXWDHPIXHND-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|