C21H24ClNO — CID 19097806
3-(3-chlorophenyl)-4-ethyl-1-(3-propan-2-ylphenyl)pyrrolidin-2-one (PubChem CID 19097806) has the molecular formula C21H24ClNO and a molecular weight of 341.88 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4-ethyl-1-(3-propan-2-ylphenyl)pyrrolidin-2-one.
| Compound Name | 3-(3-chlorophenyl)-4-ethyl-1-(3-propan-2-ylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 19097806 |
| Molecular Formula | C21H24ClNO |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-(3-chlorophenyl)-4-ethyl-1-(3-propan-2-ylphenyl)pyrrolidin-2-one |
| SMILES | CCC1CN(c2cccc(C(C)C)c2)C(=O)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H24ClNO/c1-4-15-13-23(19-10-6-7-16(12-19)14(2)3)21(24)20(15)17-8-5-9-18(22)11-17/h5-12,14-15,20H,4,13H2,1-3H3 |
| InChIKey | QRHDQIGANOWLRG-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |