C14H24N2O5 — CID 19099346
prop-2-enyl N-[3-hydroxy-2-[(prop-2-enoxycarbonylamino)methyl]butyl]-N-methylcarbamate (PubChem CID 19099346) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is prop-2-enyl N-[3-hydroxy-2-[(prop-2-enoxycarbonylamino)methyl]butyl]-N-methylcarbamate.
| Compound Name | prop-2-enyl N-[3-hydroxy-2-[(prop-2-enoxycarbonylamino)methyl]butyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 19099346 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | prop-2-enyl N-[3-hydroxy-2-[(prop-2-enoxycarbonylamino)methyl]butyl]-N-methylcarbamate |
| SMILES | C=CCOC(=O)NCC(CN(C)C(=O)OCC=C)C(C)O |
| InChI | InChI=1S/C14H24N2O5/c1-5-7-20-13(18)15-9-12(11(3)17)10-16(4)14(19)21-8-6-2/h5-6,11-12,17H,1-2,7-10H2,3-4H3,(H,15,18) |
| InChIKey | PNZFEOUSDNMKFN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|