C24H17N3O5 — CID 19101008
N-acetyl-N-[3-cyano-4-(3-nitrophenyl)-4H-benzo[h]chromen-2-yl]acetamide (PubChem CID 19101008) has the molecular formula C24H17N3O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is N-acetyl-N-[3-cyano-4-(3-nitrophenyl)-4H-benzo[h]chromen-2-yl]acetamide.
| Compound Name | N-acetyl-N-[3-cyano-4-(3-nitrophenyl)-4H-benzo[h]chromen-2-yl]acetamide |
|---|---|
| PubChem CID | 19101008 |
| Molecular Formula | C24H17N3O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-acetyl-N-[3-cyano-4-(3-nitrophenyl)-4H-benzo[h]chromen-2-yl]acetamide |
| SMILES | CC(=O)N(C(C)=O)C1=C(C#N)C(c2cccc([N+](=O)[O-])c2)c2ccc3ccccc3c2O1 |
| InChI | InChI=1S/C24H17N3O5/c1-14(28)26(15(2)29)24-21(13-25)22(17-7-5-8-18(12-17)27(30)31)20-11-10-16-6-3-4-9-19(16)23(20)32-24/h3-12,22H,1-2H3 |
| InChIKey | UZLDAOIRJMPDOO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 113.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|