C17H23NO3SSi — CID 19101651
[4-[tert-butyl(dimethyl)silyl]oxy-1,3-thiazol-2-yl]-(3-methoxyphenyl)methanone (PubChem CID 19101651) has the molecular formula C17H23NO3SSi and a molecular weight of 349.53 g/mol. Its IUPAC name is [4-[tert-butyl(dimethyl)silyl]oxy-1,3-thiazol-2-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [4-[tert-butyl(dimethyl)silyl]oxy-1,3-thiazol-2-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 19101651 |
| Molecular Formula | C17H23NO3SSi |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [4-[tert-butyl(dimethyl)silyl]oxy-1,3-thiazol-2-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)c2nc(O[Si](C)(C)C(C)(C)C)cs2)c1 |
| InChI | InChI=1S/C17H23NO3SSi/c1-17(2,3)23(5,6)21-14-11-22-16(18-14)15(19)12-8-7-9-13(10-12)20-4/h7-11H,1-6H3 |
| InChIKey | JECMZSOWDNGNNZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|