C21H25F2N5O2 — CID 19101697
1-N-benzyl-3-N-cyclopropyl-4,6-difluoro-5-(4-methylpiperazin-1-yl)-2-nitrobenzene-1,3-diamine (PubChem CID 19101697) has the molecular formula C21H25F2N5O2 and a molecular weight of 417.46 g/mol. Its IUPAC name is 1-N-benzyl-3-N-cyclopropyl-4,6-difluoro-5-(4-methylpiperazin-1-yl)-2-nitrobenzene-1,3-diamine.
| Compound Name | 1-N-benzyl-3-N-cyclopropyl-4,6-difluoro-5-(4-methylpiperazin-1-yl)-2-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 19101697 |
| Molecular Formula | C21H25F2N5O2 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 1-N-benzyl-3-N-cyclopropyl-4,6-difluoro-5-(4-methylpiperazin-1-yl)-2-nitrobenzene-1,3-diamine |
| SMILES | CN1CCN(c2c(F)c(NCc3ccccc3)c([N+](=O)[O-])c(NC3CC3)c2F)CC1 |
| InChI | InChI=1S/C21H25F2N5O2/c1-26-9-11-27(12-10-26)20-16(22)18(24-13-14-5-3-2-4-6-14)21(28(29)30)19(17(20)23)25-15-7-8-15/h2-6,15,24-25H,7-13H2,1H3 |
| InChIKey | AXCQMAGHMKJFDY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|