C32H52O4Si — CID 19103298
4-[[[4-hydroxy-3,5-bis(2-methylpropyl)phenoxy]methyl-dimethylsilyl]methoxy]-2,6-bis(2-methylpropyl)phenol (PubChem CID 19103298) has the molecular formula C32H52O4Si and a molecular weight of 528.85 g/mol. Its IUPAC name is 4-[[[4-hydroxy-3,5-bis(2-methylpropyl)phenoxy]methyl-dimethylsilyl]methoxy]-2,6-bis(2-methylpropyl)phenol.
| Compound Name | 4-[[[4-hydroxy-3,5-bis(2-methylpropyl)phenoxy]methyl-dimethylsilyl]methoxy]-2,6-bis(2-methylpropyl)phenol |
|---|---|
| PubChem CID | 19103298 |
| Molecular Formula | C32H52O4Si |
| Molecular Weight | 528.85 g/mol |
| Exact Mass | 528.36 |
| IUPAC Name | 4-[[[4-hydroxy-3,5-bis(2-methylpropyl)phenoxy]methyl-dimethylsilyl]methoxy]-2,6-bis(2-methylpropyl)phenol |
| SMILES | CC(C)Cc1cc(OC[Si](C)(C)COc2cc(CC(C)C)c(O)c(CC(C)C)c2)cc(CC(C)C)c1O |
| InChI | InChI=1S/C32H52O4Si/c1-21(2)11-25-15-29(16-26(31(25)33)12-22(3)4)35-19-37(9,10)20-36-30-17-27(13-23(5)6)32(34)28(18-30)14-24(7)8/h15-18,21-24,33-34H,11-14,19-20H2,1-10H3 |
| InChIKey | ZOKPMFSGMSEJMY-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.85 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|