C12H20BrNSi — CID 140774572
[6-bromo-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane (PubChem CID 140774572) has the molecular formula C12H20BrNSi and a molecular weight of 286.29 g/mol. Its IUPAC name is [6-bromo-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane.
| Compound Name | [6-bromo-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 140774572 |
| Molecular Formula | C12H20BrNSi |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | [6-bromo-4-(2-methylpropyl)-3-pyridinyl]-trimethylsilane |
| SMILES | CC(C)Cc1cc(Br)ncc1[Si](C)(C)C |
| InChI | InChI=1S/C12H20BrNSi/c1-9(2)6-10-7-12(13)14-8-11(10)15(3,4)5/h7-9H,6H2,1-5H3 |
| InChIKey | QEOMPAHHZMHQKR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|