C22H22N4O4 — CID 19107323
2-cyanoethyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 19107323) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-cyanoethyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | 2-cyanoethyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 19107323 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-cyanoethyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | CC1=CC(c2cccc([N+](=O)[O-])c2)C(C(=O)OCCC#N)C(C)(c2cccnc2)N1 |
| InChI | InChI=1S/C22H22N4O4/c1-15-12-19(16-6-3-8-18(13-16)26(28)29)20(21(27)30-11-5-9-23)22(2,25-15)17-7-4-10-24-14-17/h3-4,6-8,10,12-14,19-20,25H,5,11H2,1-2H3 |
| InChIKey | ZMZJVGCQWCAIFV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|