C27H27N3O5 — CID 19107535
2-phenoxyethyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 19107535) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is 2-phenoxyethyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | 2-phenoxyethyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 19107535 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 2-phenoxyethyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | CC1=CC(c2cccc([N+](=O)[O-])c2)C(C(=O)OCCOc2ccccc2)C(C)(c2cccnc2)N1 |
| InChI | InChI=1S/C27H27N3O5/c1-19-16-24(20-8-6-10-22(17-20)30(32)33)25(27(2,29-19)21-9-7-13-28-18-21)26(31)35-15-14-34-23-11-4-3-5-12-23/h3-13,16-18,24-25,29H,14-15H2,1-2H3 |
| InChIKey | QYIDGGXNDQEPRT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|