C27H25N3O5 — CID 67851025
2-phenoxyethyl 2,6-dimethyl-4-[6-(3-nitrophenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate (PubChem CID 67851025) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is 2-phenoxyethyl 2,6-dimethyl-4-[6-(3-nitrophenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 2-phenoxyethyl 2,6-dimethyl-4-[6-(3-nitrophenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 67851025 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-phenoxyethyl 2,6-dimethyl-4-[6-(3-nitrophenyl)-3-pyridinyl]-1,4-dihydropyridine-3-carboxylate |
| SMILES | CC1=CC(c2ccc(-c3cccc([N+](=O)[O-])c3)nc2)C(C(=O)OCCOc2ccccc2)=C(C)N1 |
| InChI | InChI=1S/C27H25N3O5/c1-18-15-24(21-11-12-25(28-17-21)20-7-6-8-22(16-20)30(32)33)26(19(2)29-18)27(31)35-14-13-34-23-9-4-3-5-10-23/h3-12,15-17,24,29H,13-14H2,1-2H3 |
| InChIKey | PHJJBHVTTRGEKZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|