C28H27N3O4 — CID 67850930
3-phenylprop-2-enyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 67850930) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-phenylprop-2-enyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | 3-phenylprop-2-enyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 67850930 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-phenylprop-2-enyl 2,6-dimethyl-4-(3-nitrophenyl)-2-pyridin-3-yl-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | CC1=CC(c2cccc([N+](=O)[O-])c2)C(C(=O)OCC=Cc2ccccc2)C(C)(c2cccnc2)N1 |
| InChI | InChI=1S/C28H27N3O4/c1-20-17-25(22-12-6-14-24(18-22)31(33)34)26(28(2,30-20)23-13-7-15-29-19-23)27(32)35-16-8-11-21-9-4-3-5-10-21/h3-15,17-19,25-26,30H,16H2,1-2H3 |
| InChIKey | SVDNDBVZEZTKQW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|