C24H22N2O8 — CID 67944190
2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoxy]methyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 67944190) has the molecular formula C24H22N2O8 and a molecular weight of 466.45 g/mol. Its IUPAC name is 2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoxy]methyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoxy]methyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 67944190 |
| Molecular Formula | C24H22N2O8 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoxy]methyl]-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C(C(=O)O)=C(COC/C=C/c2ccc(O)cc2)N1 |
| InChI | InChI=1S/C24H22N2O8/c1-14-20(23(28)29)21(16-5-2-6-17(12-16)26(32)33)22(24(30)31)19(25-14)13-34-11-3-4-15-7-9-18(27)10-8-15/h2-10,12,21,25,27H,11,13H2,1H3,(H,28,29)(H,30,31)/b4-3+ |
| InChIKey | NPKDGNSHEVQMPS-ONEGZZNKSA-N |
| XLogP | 3.41 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|