C12H18N8O2 — CID 19108635
4-amino-N-[2-(dimethylaminocarbamoyl)-1-methylimidazol-4-yl]-1-methylimidazole-2-carboxamide (PubChem CID 19108635) has the molecular formula C12H18N8O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 4-amino-N-[2-(dimethylaminocarbamoyl)-1-methylimidazol-4-yl]-1-methylimidazole-2-carboxamide.
| Compound Name | 4-amino-N-[2-(dimethylaminocarbamoyl)-1-methylimidazol-4-yl]-1-methylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 19108635 |
| Molecular Formula | C12H18N8O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-amino-N-[2-(dimethylaminocarbamoyl)-1-methylimidazol-4-yl]-1-methylimidazole-2-carboxamide |
| SMILES | CN(C)NC(=O)c1nc(NC(=O)c2nc(N)cn2C)cn1C |
| InChI | InChI=1S/C12H18N8O2/c1-18(2)17-12(22)10-15-8(6-20(10)4)16-11(21)9-14-7(13)5-19(9)3/h5-6H,13H2,1-4H3,(H,16,21)(H,17,22) |
| InChIKey | YGJOYDSFHGDOTE-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|