C5H7N3O2 — CID 4635498
4-amino-1-methylimidazole-2-carboxylic acid (PubChem CID 4635498) has the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. Its IUPAC name is 4-amino-1-methylimidazole-2-carboxylic acid.
| Compound Name | 4-amino-1-methylimidazole-2-carboxylic acid |
|---|---|
| PubChem CID | 4635498 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | 4-amino-1-methylimidazole-2-carboxylic acid |
| SMILES | Cn1cc(N)nc1C(=O)O |
| InChI | InChI=1S/C5H7N3O2/c1-8-2-3(6)7-4(8)5(9)10/h2H,6H2,1H3,(H,9,10) |
| InChIKey | PPQDQYBXCYQCNH-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |