C10H10Cl3NO3 — CID 19109
[2,2-dichloro-3-(2-chlorophenyl)-3-hydroxypropyl] carbamate (PubChem CID 19109) has the molecular formula C10H10Cl3NO3 and a molecular weight of 298.55 g/mol. Its IUPAC name is [2,2-dichloro-3-(2-chlorophenyl)-3-hydroxypropyl] carbamate.
| Compound Name | [2,2-dichloro-3-(2-chlorophenyl)-3-hydroxypropyl] carbamate |
|---|---|
| PubChem CID | 19109 |
| Molecular Formula | C10H10Cl3NO3 |
| Molecular Weight | 298.55 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | [2,2-dichloro-3-(2-chlorophenyl)-3-hydroxypropyl] carbamate |
| SMILES | NC(=O)OCC(Cl)(Cl)C(O)c1ccccc1Cl |
| InChI | InChI=1S/C10H10Cl3NO3/c11-7-4-2-1-3-6(7)8(15)10(12,13)5-17-9(14)16/h1-4,8,15H,5H2,(H2,14,16) |
| InChIKey | BJXPMDRBEHGNRQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|